What is the density of phenyl benzoate?
Predicted data is generated using the ACD/Labs Percepta Platform – PhysChem Module
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| Vapour Pressure: | 0.0±0.7 mmHg at 25°C |
| Enthalpy of Vaporization: | 55.5±3.0 kJ/mol |
| Flash Point: | 128.9±16.7 °C |
| Index of Refraction: | 1.585 |
How do you find the molecular weight of phenyl benzoate?
Identification of PHENYL BENZOATE Chemical Compound
| Chemical Formula | C13H10O2 |
|---|---|
| Molecular Weight | 198.2173 g/mol |
| IUPAC Name | phenyl benzoate |
| SMILES String | O=C(Oc1ccccc1)c2ccccc2 |
| InChI | InChI=1S/C13H10O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H |
What is phenyl benzoate soluble in?
Phenyl benzoate Property Water Solubility : Soluble in ethanol, ethyl ether and chloroform. Insoluble in water.
What is the density of phenol?
1.07 g/cm³
Phenol/Density
Is phenyl benzoate neutral?
Benzoic acid esters are ester derivatives of benzoic acid. 2-phenylethyl benzoate is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa).
What is phenyl benzoate used for?
Benzyl benzoate is an organic compound which is used as a medication and insect repellent. As a medication it is used to treat scabies and lice….Benzyl benzoate.
| Clinical data | |
|---|---|
| Density | 1.118 g/cm3 g/cm3 |
| Melting point | 18 °C (64 °F) |
| Boiling point | 323 °C (613 °F) |
| Solubility in water | insoluble mg/mL (20 °C) |
What is the density of ethanol?
789 kg/m³
Ethanol/Density
Is phenol a secondary alcohol?
The product of alcohol oxidation depends on whether the starting alcohol is a primary, secondary or tertiary alcohol….Structure and properties.
| Name | Phenol |
|---|---|
| Structure | C6H5OH |
| Molecular Mass | 94 |
| bp ( C) | 182 |
| Water Solubility | (3 ) |
Is phenyl benzoate polar or nonpolar?
21 Cards in this Set
| Chromatography Definition | Technique used to separate organic compounds by using a solvent (mobile phase) to move the compounds over a solid (stationary phase) |
|---|---|
| Three Compounds | 9-hydroxyfluorene (most polar) Phenyl benzoate fluorene (least polar) |
Is phenol an alcohol?
Publisher Summary. Phenols have unique properties and are not classified as alcohols. They have higher acidities due to the aromatic ring’s tight coupling with the oxygen and a relatively loose bond between the oxygen and hydrogen.
What is the formula for the benzoate ester from phenol?
Phenyl benzoate is a benzoate ester obtained by the formal condensation of phenol with benzoic acid. InChI=1S/C13H10O2/c14-13 (11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H
What is ethyl benzoate found in?
Ethyl benzoate is found in alcoholic beverages. Ethyl benzoate is found in various fruits, e. g. apple, banana, sweet cherry. Also present in milk, butter, wines, black tea, bourbon vanilla and fruit brandies. Ethyl benzoate is a flavouring agent As with many volatile esters, ethyl benzoate has a pleasant odor.
What is the use of phenyl benzoate?
Phenyl benzoate Uses. Phenyl benzoate (CAS NO.93-99-2) is heated to 130 ℃ in the presence of aluminum chloride , after rearrangement, then generates 4 – hydroxy-benzophenone, used as intermediates in organic synthesis for the production of pharmaceutical and other products.
What is the action of Fries rearrangement on phenyl benzoate?
Phenyl benzoate undergoes Fries rearrangement catalyzed by heteropoly acids to yield the acylated phenols and esters. Phenyl benzoate was used in the synthesis of soluble polyimides using dianhydride/diamine derivatives.